CAS 1208077-17-1: 2-Bromo-4-chloro-1,3-dimethylbenzene
Description:2-Bromo-4-chloro-1,3-dimethylbenzene, also known as a substituted aromatic compound, features a benzene ring with two methyl groups, a bromine atom, and a chlorine atom as substituents. This compound is characterized by its relatively high stability due to the resonance of the aromatic system, which allows for delocalization of electrons. The presence of halogen atoms (bromine and chlorine) introduces significant polarity, affecting its reactivity and solubility in various solvents. Typically, such compounds exhibit moderate to low solubility in water but are more soluble in organic solvents like dichloromethane or ethanol. The methyl groups contribute to steric hindrance, influencing the compound's reactivity in electrophilic substitution reactions. Additionally, the presence of halogens can enhance the compound's reactivity towards nucleophiles, making it useful in various synthetic applications. Safety data should be consulted, as halogenated compounds can pose health risks, including toxicity and environmental concerns. Overall, 2-Bromo-4-chloro-1,3-dimethylbenzene is a versatile compound in organic synthesis and materials science.
Formula:C8H8BrCl
InChI:InChI=1S/C8H8BrCl/c1-5-3-4-7(10)6(2)8(5)9/h3-4H,1-2H3
InChI key:InChIKey=SYJGOCCALRWSID-UHFFFAOYSA-N
SMILES:ClC1=CC=C(C(Br)=C1C)C
- Synonyms:
- Benzene, 2-bromo-4-chloro-1,3-dimethyl-
- 2-Bromo-4-chloro-1,3-dimethylbenzene
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-Bromo-4-chloro-m-xylene REF: IN-DA00HFRQCAS: 1208077-17-1 | 97% | 103.00 €~286.00 € | Wed 26 Mar 25 |
![]() | 2-Bromo-4-chloro-m-xylene REF: 10-F043085CAS: 1208077-17-1 | 95.0% | To inquire | Mon 07 Apr 25 |
![]() | 2-Bromo-4-chloro-m-xylene REF: 3D-IYB07717CAS: 1208077-17-1 | Min. 95% | - - - | Discontinued product |

2-Bromo-4-chloro-m-xylene
Ref: IN-DA00HFRQ
1g | 286.00 € | ||
100mg | 103.00 € | ||
250mg | 169.00 € |

2-Bromo-4-chloro-m-xylene
Ref: 10-F043085
1g | 408.00 € | ||
100mg | 118.00 € | ||
250mg | 189.00 € |

2-Bromo-4-chloro-m-xylene
Ref: 3D-IYB07717
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information | |
2500mg | Discontinued | Request information |