CAS 1208077-35-3
:4-Bromo-5-chloro-2-fluorobenzenesulfonamide
Description:
4-Bromo-5-chloro-2-fluorobenzenesulfonamide is an organic compound characterized by the presence of a sulfonamide functional group attached to a benzene ring that is substituted with bromine, chlorine, and fluorine atoms. This compound features a sulfonamide group (-SO2NH2), which is known for its applications in pharmaceuticals and agrochemicals due to its ability to inhibit certain biological processes. The presence of halogen substituents (bromo, chloro, and fluoro) on the benzene ring can significantly influence the compound's reactivity, solubility, and biological activity. Generally, halogenated compounds exhibit unique properties such as increased lipophilicity and altered electronic characteristics, which can enhance their interaction with biological targets. The specific arrangement of these substituents can also affect the compound's stability and potential applications in medicinal chemistry. Overall, 4-Bromo-5-chloro-2-fluorobenzenesulfonamide is a compound of interest for further research in various chemical and biological fields.
Formula:C6H4BrClFNO2S
InChI:InChI=1S/C6H4BrClFNO2S/c7-3-1-5(9)6(2-4(3)8)13(10,11)12/h1-2H,(H2,10,11,12)
InChI key:InChIKey=GOWWGEQRZSQSBM-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(F)C=C(Br)C(Cl)=C1
Synonyms:- 4-Bromo-5-chloro-2-fluorobenzenesulfonamide
- Benzenesulfonamide, 4-bromo-5-chloro-2-fluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
