
CAS 1208077-57-9
:4-(2,4-Dibromophenyl)morpholine
Description:
4-(2,4-Dibromophenyl)morpholine is an organic compound characterized by its morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. The presence of the 2,4-dibromophenyl group indicates that two bromine atoms are substituted on a phenyl ring at the 2 and 4 positions, contributing to the compound's unique properties. This substitution pattern can influence the compound's reactivity, solubility, and biological activity. Morpholine derivatives are often studied for their potential applications in pharmaceuticals, agrochemicals, and materials science due to their ability to interact with biological systems and their structural versatility. The compound may exhibit specific characteristics such as moderate to high lipophilicity, which can affect its absorption and distribution in biological systems. Additionally, the presence of bromine atoms may enhance the compound's stability and alter its electronic properties. Safety and handling considerations are essential, as halogenated compounds can pose environmental and health risks. Overall, 4-(2,4-Dibromophenyl)morpholine represents a class of compounds with diverse applications and significant interest in chemical research.
Formula:C10H11Br2NO
InChI:InChI=1S/C10H11Br2NO/c11-8-1-2-10(9(12)7-8)13-3-5-14-6-4-13/h1-2,7H,3-6H2
InChI key:InChIKey=XOYXHSRNXIQVGT-UHFFFAOYSA-N
SMILES:BrC1=C(N2CCOCC2)C=CC(Br)=C1
Synonyms:- Morpholine, 4-(2,4-dibromophenyl)-
- 4-(2,4-Dibromophenyl)morpholine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.