CAS 1208077-62-6
:2-Bromo-3,4,6-trifluorobenzenesulfonamide
Description:
2-Bromo-3,4,6-trifluorobenzenesulfonamide is a chemical compound characterized by its complex structure, which includes a bromine atom and three fluorine atoms attached to a benzene ring, along with a sulfonamide functional group. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of multiple electronegative fluorine atoms enhances its reactivity and polarity, making it useful in various chemical reactions. The sulfonamide group contributes to its solubility in polar solvents and can influence its biological activity. Additionally, the bromine substituent can serve as a site for further chemical modifications. Overall, 2-Bromo-3,4,6-trifluorobenzenesulfonamide is notable for its unique electronic properties and potential utility in synthetic organic chemistry and drug development. Safety data and handling precautions should be observed due to its chemical nature and potential biological effects.
Formula:C6H3BrF3NO2S
InChI:InChI=1S/C6H3BrF3NO2S/c7-4-5(10)2(8)1-3(9)6(4)14(11,12)13/h1H,(H2,11,12,13)
InChI key:InChIKey=DAPGXJIMHLDSLU-UHFFFAOYSA-N
SMILES:S(N)(=O)(=O)C1=C(Br)C(F)=C(F)C=C1F
Synonyms:- Benzenesulfonamide, 2-bromo-3,4,6-trifluoro-
- 2-Bromo-3,4,6-trifluorobenzenesulfonamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
