
CAS 1208077-67-1
:Ethyl 3-amino-2,4-dibromo-6-chlorobenzoate
Description:
Ethyl 3-amino-2,4-dibromo-6-chlorobenzoate is an organic compound characterized by its complex structure, which includes an ethyl ester group, an amino group, and multiple halogen substituents on a benzoate ring. The presence of bromine and chlorine atoms contributes to its reactivity and potential applications in various chemical reactions, including nucleophilic substitutions and coupling reactions. The amino group can participate in hydrogen bonding, influencing the compound's solubility and interaction with biological systems. This compound may exhibit specific biological activities, making it of interest in pharmaceutical research. Its molecular structure suggests that it could be used as an intermediate in the synthesis of more complex molecules or as a potential agrochemical. The presence of multiple halogens typically enhances the compound's stability and alters its electronic properties, which can be crucial for its reactivity and interaction with other substances. As with many halogenated compounds, safety and environmental considerations are important, particularly regarding toxicity and persistence in the environment.
Formula:C9H8Br2ClNO2
InChI:InChI=1S/C9H8Br2ClNO2/c1-2-15-9(14)6-5(12)3-4(10)8(13)7(6)11/h3H,2,13H2,1H3
InChI key:InChIKey=BRDWREXLPGOART-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C1=C(Br)C(N)=C(Br)C=C1Cl
Synonyms:- Benzoic acid, 3-amino-2,4-dibromo-6-chloro-, ethyl ester
- Ethyl 3-amino-2,4-dibromo-6-chlorobenzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.