CymitQuimica logo

CAS 1208078-01-6

:

3,5-Difluoro-4-methoxybenzenethiol

Description:
3,5-Difluoro-4-methoxybenzenethiol is an organic compound characterized by the presence of a thiol group (-SH) attached to a benzene ring that is further substituted with two fluorine atoms and a methoxy group (-OCH3). The fluorine substituents are located at the 3 and 5 positions of the benzene ring, while the methoxy group is at the 4 position, contributing to the compound's unique reactivity and properties. This compound is likely to exhibit moderate polarity due to the presence of the thiol and methoxy groups, which can engage in hydrogen bonding. The fluorine atoms can influence the electronic properties of the molecule, potentially enhancing its reactivity in certain chemical reactions. Additionally, the presence of the thiol group suggests that the compound may participate in redox reactions and can act as a nucleophile. Overall, 3,5-Difluoro-4-methoxybenzenethiol is of interest in various fields, including medicinal chemistry and materials science, due to its potential applications in synthesis and as a building block for more complex molecules.
Formula:C7H6F2OS
InChI:InChI=1S/C7H6F2OS/c1-10-7-5(8)2-4(11)3-6(7)9/h2-3,11H,1H3
InChI key:InChIKey=BKKFXQYKOYCSKU-UHFFFAOYSA-N
SMILES:O(C)C1=C(F)C=C(S)C=C1F
Synonyms:
  • Benzenethiol, 3,5-difluoro-4-methoxy-
  • 3,5-Difluoro-4-methoxybenzenethiol
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.