CAS 1208078-31-2

4-Fluoro-2,5-dimethoxyphenol

Description:

4-Fluoro-2,5-dimethoxyphenol is an organic compound characterized by the presence of a phenolic structure with two methoxy groups and a fluorine atom. Its molecular formula typically includes carbon, hydrogen, oxygen, and fluorine, reflecting its aromatic nature and functional groups. The methoxy groups (-OCH3) contribute to its solubility in organic solvents and influence its reactivity, while the fluorine atom can enhance the compound's stability and alter its electronic properties. This compound may exhibit interesting biological activities, making it of interest in medicinal chemistry and research. Its phenolic structure suggests potential antioxidant properties, and the presence of fluorine can affect its pharmacokinetics. Additionally, 4-Fluoro-2,5-dimethoxyphenol may be synthesized through various chemical reactions, including halogenation and methoxylation processes. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, this compound represents a unique combination of functional groups that can lead to diverse applications in chemical research and development.

Formula: C₈H₉FO₃

InChI: InChI=1S/C8H9FO3/c1-11-7-4-6(10)8(12-2)3-5(7)9/h3-4,10H,1-2H3

InChI key: InChIKey=KUAAIBDYIXSSSC-UHFFFAOYSA-N

SMILES: O(C)C1=C(F)C=C(OC)C(O)=C1

Synonyms:

• 4-Fluoro-2,5-dimethoxyphenol
• Phenol, 4-fluoro-2,5-dimethoxy-

4-Fluoro-2,5-dimethoxyphenol

CAS: 1208078-31-2

Formula: C₈H₉FO₃

Molecular weight: 172.1537

Ref: IN-DA008SWD