CymitQuimica logo

CAS 1208078-38-9

:

4-Chloro-2-cyclopropylbenzaldehyde

Description:
4-Chloro-2-cyclopropylbenzaldehyde is an organic compound characterized by its aromatic structure, featuring a chlorinated benzaldehyde moiety. The presence of the chloro group at the para position and a cyclopropyl group at the ortho position contributes to its unique chemical properties. This compound typically appears as a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is known for its reactivity, particularly in electrophilic aromatic substitution reactions due to the electron-withdrawing nature of the chloro substituent. The cyclopropyl group can also influence the compound's reactivity and sterics, making it an interesting candidate for various synthetic applications in organic chemistry. Additionally, 4-Chloro-2-cyclopropylbenzaldehyde may exhibit biological activity, which can be explored in medicinal chemistry. Safety data should be consulted, as halogenated compounds can pose health risks, and appropriate handling and storage conditions are essential. Overall, this compound serves as a valuable building block in the synthesis of more complex organic molecules.
Formula:C10H9ClO
InChI:InChI=1S/C10H9ClO/c11-9-4-3-8(6-12)10(5-9)7-1-2-7/h3-7H,1-2H2
InChI key:InChIKey=XJXGOQCLEHMUSX-UHFFFAOYSA-N
SMILES:C(=O)C1=C(C=C(Cl)C=C1)C2CC2
Synonyms:
  • Benzaldehyde, 4-chloro-2-cyclopropyl-
  • 4-Chloro-2-cyclopropylbenzaldehyde
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.