
CAS 1208078-44-7
:3-(1,1,2,2,2-Pentafluoroethoxy)pyrrolidine
Description:
3-(1,1,2,2,2-Pentafluoroethoxy)pyrrolidine is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a pentafluoroethoxy group. The presence of the pentafluoroethoxy moiety imparts significant fluorine content, which can enhance the compound's hydrophobicity and thermal stability. This compound is likely to exhibit interesting properties such as low surface tension and high chemical resistance, making it potentially useful in various applications, including pharmaceuticals and materials science. The pyrrolidine ring contributes to the compound's basicity and potential reactivity, allowing for various chemical transformations. Additionally, the fluorinated ethoxy group may influence the compound's solubility and interaction with biological systems. Overall, 3-(1,1,2,2,2-Pentafluoroethoxy)pyrrolidine represents a class of fluorinated compounds that are of interest for their unique physical and chemical properties, which can be leveraged in specialized applications.
Formula:C6H8F5NO
InChI:InChI=1S/C6H8F5NO/c7-5(8,9)6(10,11)13-4-1-2-12-3-4/h4,12H,1-3H2
InChI key:InChIKey=AYIYFHYRAJPVIO-UHFFFAOYSA-N
SMILES:O(C(C(F)(F)F)(F)F)C1CCNC1
Synonyms:- Pyrrolidine, 3-(1,1,2,2,2-pentafluoroethoxy)-
- 3-(1,1,2,2,2-Pentafluoroethoxy)pyrrolidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.