
CAS 1208080-29-8
:2-[(Trifluoromethoxy)methyl]piperidine
Description:
2-[(Trifluoromethoxy)methyl]piperidine is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated nitrogen-containing heterocycle. The presence of a trifluoromethoxy group (-O-CF3) attached to a methylene (-CH2-) linker enhances its chemical reactivity and influences its physical properties. This compound is typically colorless to pale yellow in appearance and may exhibit a distinct odor. It is soluble in organic solvents, reflecting its non-polar characteristics due to the trifluoromethyl group, which can impart unique electronic properties. The trifluoromethoxy group also contributes to the compound's potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as it can modulate biological activity and improve metabolic stability. Additionally, the presence of the piperidine moiety may enhance interactions with biological targets. Safety data should be consulted for handling and storage, as compounds with trifluoromethyl groups can exhibit toxicity and environmental persistence.
Formula:C7H12F3NO
InChI:InChI=1S/C7H12F3NO/c8-7(9,10)12-5-6-3-1-2-4-11-6/h6,11H,1-5H2
InChI key:InChIKey=NBXMZHXLXHFGLZ-UHFFFAOYSA-N
SMILES:C(OC(F)(F)F)C1CCCCN1
Synonyms:- Piperidine, 2-[(trifluoromethoxy)methyl]-
- 2-[(Trifluoromethoxy)methyl]piperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.