
CAS 1208081-40-6: Piperazine, 1-[5-bromo-6-chloro-4-(trifluoromethyl)-2-pyridinyl]-, hydrobromide (1:1)
Description:Piperazine, 1-[5-bromo-6-chloro-4-(trifluoromethyl)-2-pyridinyl]-, hydrobromide (1:1) is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a pyridine ring substituted with a bromine atom, a chlorine atom, and a trifluoromethyl group, contributing to its unique chemical properties and potential biological activity. The hydrobromide salt form indicates that it is combined with hydrobromic acid, enhancing its solubility in polar solvents, which is often advantageous for pharmaceutical applications. The presence of halogen substituents typically influences the compound's reactivity, stability, and interaction with biological targets. This compound may exhibit various pharmacological effects, making it of interest in medicinal chemistry. However, specific applications and safety profiles would require further investigation, including studies on its toxicity and efficacy in biological systems. As with all chemical substances, proper handling and safety measures should be observed due to potential hazards associated with its components.
Formula:C10H10BrClF3N3·BrH
InChI:InChI=1S/C10H10BrClF3N3.BrH/c11-8-6(10(13,14)15)5-7(17-9(8)12)18-3-1-16-2-4-18;/h5,16H,1-4H2;1H
InChI key:InChIKey=RAAMWTYXMBGXRV-UHFFFAOYSA-N
SMILES:Br.FC(F)(F)C1=CC(=NC(Cl)=C1Br)N2CCNCC2
- Synonyms:
- Piperazine, 1-[5-bromo-6-chloro-4-(trifluoromethyl)-2-pyridinyl]-, hydrobromide (1:1)

1'-(5-Bromo-6-chloro-4-(trifluoromethyl)pyridin-2-yl)piperazine hydrobromide
Ref: 54-PC446019
1g | 329.00 € |

1-(5-Bromo-6-chloro-4-(trifluoromethyl)pyridin-2-yl)piperazine hydrobromide
Ref: 10-F047301
1g | To inquire | ||
5g | To inquire |

1-(5-Bromo-6-chloro-4-(trifluoromethyl)pyridin-2-yl)piperazine hydrobromide
Ref: 3D-IYB08140
1g | Discontinued | Request information | |
5g | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |