CAS 1208081-83-7

Ethanamine, 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]thio]-, hydrochloride (1:1)

Description:

Ethanamine, 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]thio]-, hydrochloride (1:1), with CAS number 1208081-83-7, is a chemical compound characterized by its amine functional group and a pyridine ring substituted with a chloro and trifluoromethyl group. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. The presence of the trifluoromethyl group contributes to its lipophilicity and potential biological activity, making it of interest in pharmaceutical research. The thioether linkage indicates that it may participate in various chemical reactions, including nucleophilic substitutions. Its hydrochloride form suggests that it can be used in various applications, including as a reagent in organic synthesis or as a potential therapeutic agent. Safety data should be consulted, as compounds with halogenated substituents can exhibit toxicity and environmental persistence. Overall, this compound's unique structural features may confer specific properties that are valuable in medicinal chemistry and material science.

Formula: C₈H₈ClF₃N₂S·ClH

InChI: InChI=1S/C8H8ClF3N2S.ClH/c9-6-3-5(8(10,11)12)4-7(14-6)15-2-1-13;/h3-4H,1-2,13H2;1H

InChI key: InChIKey=HTAVYWCHQGYYAT-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(SCCN)N=C(Cl)C1.Cl

Synonyms:

• Ethanamine, 2-[[6-chloro-4-(trifluoromethyl)-2-pyridinyl]thio]-, hydrochloride (1:1)

6-Chloro-2-(2-aminoethyl)sulphanyl-4-(trifluoromethyl)pyridine hydrochloride

CAS: 1208081-83-7

6-Chloro-2-(2-aminoethyl)sulphanyl-4-(trifluoromethyl)pyridine hydrochloride

Purity: ≥95%

Molecular weight: 293.14g/mol

Ref: 54-PC400676

2-{[6-Chloro-4-(trifluoromethyl)pyridin-2-yl]thio}ethylamine hydrochloride

CAS: 1208081-83-7

Formula: C₈H₉Cl₂F₃N₂S

Purity: 95.0%

Molecular weight: 293.13

Ref: 10-F316755