CAS 1208081-85-9

Methyl 4-(acetyloxy)tetrahydro-3-thiophenecarboxylate

Description:

Methyl 4-(acetyloxy)tetrahydro-3-thiophenecarboxylate is an organic compound characterized by its unique structure, which includes a tetrahydrothiophene ring and an acetyloxy functional group. This compound features a methyl ester group, contributing to its reactivity and solubility in organic solvents. The presence of the thiophene ring imparts aromatic characteristics, while the tetrahydro configuration suggests a saturated cyclic structure, which can influence its chemical behavior and stability. The acetyloxy group enhances its potential for further chemical modifications, making it a valuable intermediate in organic synthesis. This compound may exhibit biological activity, which is common among thiophene derivatives, and could be of interest in pharmaceutical research. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, Methyl 4-(acetyloxy)tetrahydro-3-thiophenecarboxylate represents a versatile structure in organic chemistry with potential applications in various fields.

Formula: C₈H₁₂O₄S

InChI: InChI=1S/C8H12O4S/c1-5(9)12-7-4-13-3-6(7)8(10)11-2/h6-7H,3-4H2,1-2H3

InChI key: InChIKey=VXAASVIFFGHFKA-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1C(OC(C)=O)CSC1

Synonyms:

• 3-Thiophenecarboxylic acid, 4-(acetyloxy)tetrahydro-, methyl ester
• Methyl 4-(acetyloxy)tetrahydro-3-thiophenecarboxylate