CAS 1208082-00-1

4-[6-(Dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]benzamide

Description:

4-[6-(Dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]benzamide, identified by its CAS number 1208082-00-1, is a chemical compound that features a complex structure combining a benzamide moiety with a pyridine ring substituted with a dimethylamino group and a trifluoromethyl group. This compound is characterized by its potential biological activity, often explored in medicinal chemistry for its pharmacological properties. The presence of the dimethylamino group suggests it may exhibit basic characteristics, while the trifluoromethyl group can enhance lipophilicity and influence the compound's interaction with biological targets. The pyridine ring contributes to the compound's aromaticity and stability. Additionally, the compound's solubility, reactivity, and overall behavior in various environments can be significantly affected by these functional groups. As with many compounds in this class, it may be of interest in the development of pharmaceuticals, particularly in the context of targeting specific biological pathways or receptors. Safety and handling considerations should be observed due to the presence of fluorinated groups, which can pose environmental and health risks.

Formula: C₁₅H₁₄F₃N₃O

InChI: InChI=1S/C15H14F3N3O/c1-21(2)13-8-11(15(16,17)18)7-12(20-13)9-3-5-10(6-4-9)14(19)22/h3-8H,1-2H3,(H2,19,22)

InChI key: InChIKey=GHBDSEVMNMITTP-UHFFFAOYSA-N

SMILES: C(F)(F)(F)C=1C=C(N=C(N(C)C)C1)C2=CC=C(C(N)=O)C=C2

Synonyms:

• 4-[6-(Dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]benzamide
• Benzamide, 4-[6-(dimethylamino)-4-(trifluoromethyl)-2-pyridinyl]-

4-(6-Dimethylamino-4-trifluoromethylpyridin-2-yl)benzamide

CAS: 1208082-00-1

Formula: C₁₅H₁₄F₃N₃O

Purity: 95.0%

Molecular weight: 309.292

Ref: 10-F316814