CAS 1208082-43-2

3-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid

Description:

3-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid is a heterocyclic compound characterized by the presence of both bromine and a carboxylic acid functional group. This compound features a fused imidazole and pyrazine ring system, which contributes to its unique chemical properties and potential biological activity. The bromine atom introduces a halogen, which can enhance the compound's reactivity and influence its interactions in various chemical environments. The carboxylic acid group provides acidic properties, allowing for potential hydrogen bonding and solubility in polar solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in the synthesis of more complex molecules or as a building block in the development of pharmaceuticals. Additionally, the presence of the bromine atom may facilitate further functionalization, expanding its utility in organic synthesis. Overall, 3-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid represents a versatile compound with significant implications in chemical research and development.

Formula: C₇H₄BrN₃O₂

InChI: InChI=1S/C7H4BrN3O2/c8-4-3-10-6-5(7(12)13)9-1-2-11(4)6/h1-3H,(H,12,13)

InChI key: InChIKey=VPSLZKQSMGMMQP-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2N(C(Br)=CN2)C=CN1

Synonyms:

• 3-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid
• Imidazo[1,2-a]pyrazine-8-carboxylic acid, 3-bromo-

3-Bromoimidazo[1,2-a]pyrazine-8-carboxylic acid

CAS: 1208082-43-2

Versatile small molecule scaffold

Formula: C₇H₄BrN₃O₂

Purity: Min. 95%

Molecular weight: 242.03 g/mol

Ref: 3D-IYB08243