CAS 120809-58-7

Trimethylsilyl 3-pyridazinecarboxylate

Description:

Trimethylsilyl 3-pyridazinecarboxylate is an organosilicon compound characterized by the presence of a trimethylsilyl group attached to a pyridazinecarboxylate moiety. This compound typically exhibits properties associated with both silanes and heterocyclic compounds. It is likely to be a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The trimethylsilyl group enhances its volatility and solubility in organic solvents, making it useful in various synthetic applications, particularly in organic synthesis and as a protecting group for carboxylic acids. The pyridazine ring contributes to its reactivity, allowing for potential interactions in nucleophilic substitution reactions. Additionally, the compound may exhibit moderate stability under standard conditions but could be sensitive to moisture due to the presence of the silyl group. Overall, Trimethylsilyl 3-pyridazinecarboxylate serves as a valuable intermediate in chemical synthesis, particularly in the development of pharmaceuticals and agrochemicals.

Formula: C₈H₁₂N₂O₂Si

InChI: InChI=1S/C8H12N2O2Si/c1-13(2,3)12-8(11)7-5-4-6-9-10-7/h4-6H,1-3H3

InChI key: InChIKey=ADCGEMDOZGYVGB-UHFFFAOYSA-N

SMILES: C(O[Si](C)(C)C)(=O)C1=CC=CN=N1

Synonyms:

• Trimethylsilyl 3-pyridazinecarboxylate
• 3-Pyridazinecarboxylic acid, trimethylsilyl ester