
CAS 1208170-22-2
:1-(Phenylsulfonyl)-1H-pyrazol-4-amine
Description:
1-(Phenylsulfonyl)-1H-pyrazol-4-amine is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. The presence of a phenylsulfonyl group enhances its reactivity and solubility in various solvents. This compound typically exhibits properties such as moderate to high stability under standard conditions, and it may participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, due to the functional groups present. Its sulfonamide moiety can influence its biological activity, making it of interest in medicinal chemistry for potential pharmaceutical applications. The compound may also display specific spectral characteristics in techniques such as NMR and IR spectroscopy, which can be used for its identification and characterization. Overall, 1-(Phenylsulfonyl)-1H-pyrazol-4-amine is a versatile compound with potential applications in drug development and synthetic chemistry.
Formula:C9H9N3O2S
InChI:InChI=1S/C9H9N3O2S/c10-8-6-11-12(7-8)15(13,14)9-4-2-1-3-5-9/h1-7H,10H2
InChI key:InChIKey=PWQXSOVACFDBDD-UHFFFAOYSA-N
SMILES:S(=O)(=O)(N1C=C(N)C=N1)C2=CC=CC=C2
Synonyms:- 1-(Phenylsulfonyl)-1H-pyrazol-4-amine
- 1H-Pyrazol-4-amine, 1-(phenylsulfonyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.