
CAS 120824-03-5
:Withangulatin A
Description:
Withangulatin A is a natural compound classified as a withanolide, which is a type of steroidal lactone primarily derived from plants in the Solanaceae family, particularly from the genus Withania. This compound is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and anticancer activities. Withangulatin A exhibits a complex molecular structure characterized by a fused steroid framework, which contributes to its biological activity. It is typically isolated from the roots or leaves of Withania somnifera, commonly known as ashwagandha, a plant renowned for its adaptogenic properties. The compound's mechanism of action may involve modulation of various signaling pathways, making it a subject of interest in medicinal chemistry and pharmacology. Additionally, Withangulatin A's safety profile and therapeutic potential are areas of ongoing research, highlighting its significance in traditional medicine and modern therapeutic applications. As with many natural products, further studies are necessary to fully elucidate its mechanisms and potential benefits in human health.
Formula:C30H38O8
InChI:InChI=1S/C30H38O8/c1-14-11-21(37-26(34)15(14)2)16(3)19-12-24(36-17(4)31)29(35)20-13-25-30(38-25)23(33)8-7-22(32)28(30,6)18(20)9-10-27(19,29)5/h7-8,12,16,18,20-21,23-25,33,35H,9-11,13H2,1-6H3/t16-,18-,20+,21+,23-,24-,25+,27+,28-,29-,30+/m0/s1
InChI key:InChIKey=PLPXOWZTDPJPHC-ISIACCJKSA-N
SMILES:C[C@]12[C@]3([C@](O3)(C[C@@]4([C@@]1(CC[C@@]5(C)[C@@]4(O)[C@@H](OC(C)=O)C=C5[C@H](C)[C@]6(CC(C)=C(C)C(=O)O6)[H])[H])[H])[H])[C@@H](O)C=CC2=O
Synonyms:- 5,6-Epoxy-5H-cyclopenta[a]phenanthrene, ergosta-2,16,24-trien-26-oic acid deriv.
- Withangulatin A
- Withagulatin A
- Ergosta-2,16,24-trien-26-oic acid, 15-(acetyloxy)-5,6-epoxy-4,14,22-trihydroxy-1-oxo-, δ-lactone, (4β,5α,6β,15α,22R)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Withangulatin A
CAS:Withangulatin A, a COX-2 inhibitor from Physalis angulata, has anti-tumor and anti-inflammatory effects.Formula:C30H38O8Color and Shape:SolidMolecular weight:526.62
