CymitQuimica logo

CAS 1208318-89-1

:

B-[4-Chloro-2-(methoxymethyl)phenyl]boronic acid

Description:
B-[4-Chloro-2-(methoxymethyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The compound features a chlorinated phenyl ring, which can influence its reactivity and solubility, as well as a methoxymethyl substituent that may enhance its stability and solubility in organic solvents. Boronic acids are typically used in Suzuki coupling reactions, a key method for forming carbon-carbon bonds in the synthesis of complex organic molecules. The presence of the chlorine atom can also provide opportunities for further functionalization or modification. Additionally, the compound's boronic acid group can participate in interactions with biological molecules, making it of interest in drug development and biochemical research. Overall, B-[4-Chloro-2-(methoxymethyl)phenyl]boronic acid is a versatile compound with significant potential in both synthetic and medicinal chemistry.
Formula:C8H10BClO3
InChI:InChI=1S/C8H10BClO3/c1-13-5-6-4-7(10)2-3-8(6)9(11)12/h2-4,11-12H,5H2,1H3
InChI key:InChIKey=YOJVVDGTPSRYMU-UHFFFAOYSA-N
SMILES:B(O)(O)C1=C(COC)C=C(Cl)C=C1
Synonyms:
  • Boronic acid, B-[4-chloro-2-(methoxymethyl)phenyl]-
  • B-[4-Chloro-2-(methoxymethyl)phenyl]boronic acid
  • [4-Chloro-2-(methoxymethyl)phenyl]boronic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.