CAS 120842-54-8

1-(2-chloroethyl)-3-methyl-1H-pyrazole-4-carbaldehyde

Description:

1-(2-Chloroethyl)-3-methyl-1H-pyrazole-4-carbaldehyde is a chemical compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a chloroethyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the aldehyde functional group indicates that it can participate in various chemical reactions, such as nucleophilic addition and condensation reactions. The methyl group at the 3-position of the pyrazole ring influences its steric and electronic properties, potentially affecting its biological activity. This compound may be of interest in medicinal chemistry and agrochemicals due to its unique structure and functional groups. Additionally, its CAS number, 120842-54-8, allows for easy identification and reference in chemical databases. Overall, the characteristics of this compound suggest it may have diverse applications in research and industry, particularly in the development of new pharmaceuticals or agrochemical agents.

Formula: C₇H₉ClN₂O

InChI: InChI=1/C7H9ClN2O/c1-6-7(5-11)4-10(9-6)3-2-8/h4-5H,2-3H2,1H3

SMILES: Cc1c(cn(CCCl)n1)C=O

1-(2-chloroethyl)-3-methyl-1H-pyrazole-4-carbaldehyde

CAS: 120842-54-8

Formula: C₇H₉ClN₂O

Purity: 95.0%

Molecular weight: 172.61

Ref: 10-F308469