CAS 120849-18-5
:Physalin O
Description:
Physalin O is a natural compound classified as a steroidal saponin, primarily derived from the plant Physalis angulata, commonly known as the cutleaf groundcherry. This compound exhibits a range of biological activities, including anti-inflammatory, antiviral, and anticancer properties, making it of interest in pharmacological research. Physalin O is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its bioactivity. The compound has been studied for its potential therapeutic applications, particularly in the treatment of various diseases, including cancer and viral infections. Its mechanism of action often involves modulation of cellular pathways, influencing cell proliferation and apoptosis. Additionally, Physalin O's solubility and stability in different solvents can vary, which is important for its formulation in medicinal applications. Overall, Physalin O represents a significant area of study in natural product chemistry and its potential uses in medicine.
Formula:C28H32O10
InChI:InChI=1S/C28H32O10/c1-12-21(32)36-17-11-23(12,2)19-20(31)27(35)18-14(24(3)13(10-15(18)29)6-5-7-16(24)30)8-9-26(34)22(33)37-25(17,4)28(19,26)38-27/h5,7,10,12,14-15,17-19,29,34-35H,6,8-9,11H2,1-4H3/t12-,14+,15-,17-,18+,19+,23-,24+,25+,26+,27-,28+/m1/s1
InChI key:InChIKey=QFAOFAWTSOFSQA-HRLARMCRSA-N
SMILES:C[C@@]12[C@]34[C@]([C@]5(C)C[C@]1(OC(=O)[C@H]5C)[H])(C(=O)[C@](O)(O3)[C@]6([C@](CC[C@]4(O)C(=O)O2)([C@]7(C)C(=C[C@H]6O)CC=CC7=O)[H])[H])[H]
Synonyms:- Physalin O
- (1S,2S,3S,6R,6aS,8aR,10aS,10bR,16R,16aS,17R,18aR)-2,3,6,6a,9,10,10a,10b,14,16,16a,17-Dodecahydro-8a,16,17-trihydroxy-2,3,6a,10b-tetramethyl-1,17:2,6-dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,19(1H,8aH)-tetrone
- (-)-Physalin O
- 16,24-Cyclo-13,14-secoergosta-2,5-diene-18,26-dioic acid, 14,17-epoxy-7,13,14,14,20,22-hexahydroxy-1,15-dioxo-, 18,20:26,22-dilactone, (7α,14α,16β,22α,25S)-
- 1,17:2,6-Dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c′]bisoxocin-4,8,11,19(1H,8aH)-tetrone, 2,3,6,6a,9,10,10a,10b,14,16,16a,17-dodecahydro-8a,16,17-trihydroxy-2,3,6a,10b-tetramethyl-, (1S,2S,3S,6R,6aS,8aR,10aS,10bR,16R,16aS,17R,18aR)-
- 16,24-Cyclo-13,14-secoergosta-2,5-diene-18,26-dioicacid, 14,17-epoxy-7,13,14,14,20,22-hexahydroxy-1,15-dioxo-,18,20:26,22-dilactone, (7a,14a,16b,22a,25S)-
- 1,17:2,6-Dimethano-8H-naphtho[1,2-f]furo[3,4-b:2,3-c']bisoxocin-4,8,11,19(1H,8aH)-tetrone,2,3,6,6a,9,10,10a,10b,14,16,16a,17-dodecahydro-8a,16,17-trihydroxy-2,3,6a,10b-tetramethyl-,[1S-(1a,2b,3b,6b,6aa,8aa,10aa,10bb,16a,16ab,17b,18aS*)]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Physalin O
CAS:Physalin O,Physalin from Physalis angulata. Cytotoxic to Hep G2 (IC50=31.1 μM) and MCF-7 (11.4 μM). Inhibits NO production. Anti-inflammatory.Formula:C28H32O10Purity:99.94%Color and Shape:SolidMolecular weight:528.55Physalin O
CAS:Physalin O is a bioactive compound classified as a steroid, specifically sourced from the Physalis species, which is a genus of plants in the Solanaceae family. These plants are traditionally used in various medicinal applications due to their rich phytochemical content. The mode of action of Physalin O involves interacting with cellular pathways to exert antiproliferative effects, primarily through the modulation of cell cycle regulators and apoptotic mechanisms.Formula:C28H32O10Purity:Min. 95%Molecular weight:528.50 g/mol


