CAS 120882-22-6: Desfuroyl Ceftiofur
Description:Desfuroyl Ceftiofur, with the CAS number 120882-22-6, is a metabolite of the cephalosporin antibiotic ceftiofur, primarily used in veterinary medicine. It exhibits broad-spectrum antibacterial activity, particularly against Gram-negative bacteria, making it effective in treating infections in livestock. The compound is characterized by its stability and solubility in water, which facilitates its administration in injectable formulations. Desfuroyl Ceftiofur is known for its relatively low toxicity profile, contributing to its safety in veterinary applications. Its mechanism of action involves inhibiting bacterial cell wall synthesis, leading to cell lysis and death. Additionally, it is important to monitor its residues in food products, as regulatory agencies set limits to ensure consumer safety. The pharmacokinetics of Desfuroyl Ceftiofur indicate a prolonged half-life, allowing for less frequent dosing in clinical settings. Overall, its efficacy and safety profile make it a valuable tool in managing bacterial infections in animals.
Formula:C14H15N5O5S3
InChI:InChI=1/C14H15N5O5S3/c1-24-18-7(6-4-27-14(15)16-6)10(20)17-8-11(21)19-9(13(22)23)5(2-25)3-26-12(8)19/h4,8,12,25H,2-3H2,1H3,(H2,15,16)(H,17,20)(H,22,23)/b18-7+/t8-,12-/m1/s1
- Synonyms:
- (6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-3-(mercaptomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Aci
- (6R,7R)-7-[[(2Z)-(2-Amino-4-thiazolyl)(methoxyimino)acetyl]amino]-3-(mercaptomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic Acid
- (6R,7R)-7-{[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-3-(sulfanylmethyl)-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid