CAS 1208864-37-2
:8-Bromo-2-ethenylquinoline
Description:
8-Bromo-2-ethenylquinoline is an organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of a bromine atom at the 8-position and an ethenyl group at the 2-position contributes to its unique reactivity and properties. This compound typically exhibits a yellow to brown color and is soluble in organic solvents, making it useful in various chemical applications. Its structure allows for potential interactions in biological systems, which may be explored for pharmaceutical applications. The bromine substituent can enhance the compound's electrophilic character, making it a candidate for further chemical modifications. Additionally, the ethenyl group can participate in various reactions, such as polymerization or cross-coupling reactions, expanding its utility in synthetic organic chemistry. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns. Overall, 8-Bromo-2-ethenylquinoline is a versatile compound with applications in research and industry.
Formula:C11H8BrN
InChI:InChI=1S/C11H8BrN/c1-2-9-7-6-8-4-3-5-10(12)11(8)13-9/h2-7H,1H2
InChI key:InChIKey=SZWBYWASQUJBOD-UHFFFAOYSA-N
SMILES:BrC=1C2=C(C=CC(C=C)=N2)C=CC1
Synonyms:- Quinoline, 8-bromo-2-ethenyl-
- 8-Bromo-2-ethenylquinoline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.