CAS 120889-04-5
:1-methyl-6-phenyl-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one
Description:
1-Methyl-6-phenyl-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one is a heterocyclic compound characterized by its imidazopyridinone structure, which incorporates both nitrogen and carbon atoms in its ring system. This compound typically exhibits a fused bicyclic structure, contributing to its unique chemical properties. It is known for its potential biological activity, often investigated for applications in medicinal chemistry, particularly in the development of pharmaceuticals. The presence of the methyl and phenyl groups enhances its lipophilicity, which can influence its absorption and distribution in biological systems. Additionally, the imidazopyridinone framework may participate in various chemical reactions, making it a versatile building block in organic synthesis. Its solubility and stability can vary depending on the solvent and environmental conditions, which are important factors to consider in practical applications. Overall, this compound represents a significant interest in both synthetic and medicinal chemistry due to its structural features and potential therapeutic properties.
Formula:C13H11N3O
InChI:InChI=1/C13H11N3O/c1-16-11-7-10(9-5-3-2-4-6-9)8-14-12(11)15-13(16)17/h2-8H,1H3,(H,14,15,17)
SMILES:Cn1c2cc(cnc2nc1O)c1ccccc1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-Hydroxy-1-methyl-6-phenylimidazo[4,5-b]pyridine
CAS:Controlled ProductApplications 2-Hydroxy-1-methyl-6-phenylimidazo[4,5-b]pyridine (cas# 120889-04-5) is a compound useful in organic synthesis.
Formula:C13H11N3OColor and Shape:NeatMolecular weight:225.25

