CAS 120889-05-6

2-Chloro-1-methyl-6-phenyl-1H-imidazo[4,5-b]pyridine

Description:

2-Chloro-1-methyl-6-phenyl-1H-imidazo[4,5-b]pyridine is a heterocyclic organic compound characterized by its imidazo[4,5-b]pyridine core structure, which incorporates both nitrogen and carbon atoms in a fused ring system. This compound features a chlorine atom at the 2-position, a methyl group at the 1-position, and a phenyl group at the 6-position, contributing to its unique chemical properties. It is typically a solid at room temperature and exhibits moderate solubility in organic solvents. The presence of the chlorine atom can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The phenyl group enhances its aromatic character, which may affect its electronic properties and interactions with biological targets. This compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific biological activities. As with many heterocycles, it may also exhibit interesting photophysical properties, making it relevant in materials science and organic electronics.

Formula: C₁₃H₁₀ClN₃

InChI: InChI=1S/C13H10ClN3/c1-17-11-7-10(9-5-3-2-4-6-9)8-15-12(11)16-13(17)14/h2-8H,1H3

InChI key: InChIKey=FBFVKWMIRFROSV-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C1Cl)=NC=C(C2)C3=CC=CC=C3

Synonyms:

• 1H-Imidazo[4,5-b]pyridine, 2-chloro-1-methyl-6-phenyl-
• 2-chloro-1-methyl-6-phenyl-1H-imidazo[4,5-b]pyridine
• 2-Chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine

2-Chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine

Controlled Product

CAS: 120889-05-6

Applications 2-Chloro-1-methyl-6-phenylimidazo[4,5-b]pyridine (cas# 120889-05-6) is a compound useful in organic synthesis.

Formula: C₁₃H₁₀ClN₃

Color and Shape: Neat

Molecular weight: 243.69

Ref: TR-C369310