CAS 120890-70-2
:propan-2-yl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidi n-1-yl]benzoate
Description:
Propan-2-yl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)pyrimidin-1-yl]benzoate, with CAS number 120890-70-2, is a synthetic organic compound characterized by its complex molecular structure, which includes a benzoate moiety, a chloro substituent, and a pyrimidine derivative. This compound typically exhibits properties such as moderate solubility in organic solvents and potential reactivity due to the presence of functional groups like the chloro and carbonyl groups. Its molecular structure suggests it may possess biological activity, potentially acting as an inhibitor or modulator in various biochemical pathways. The trifluoromethyl group may enhance lipophilicity, influencing its pharmacokinetic properties. Additionally, the presence of multiple functional groups indicates that it could participate in various chemical reactions, making it of interest in medicinal chemistry and drug development. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C16H14ClF3N2O4
InChI:InChI=1/C16H14ClF3N2O4/c1-8(2)26-14(24)10-6-9(4-5-11(10)17)22-13(23)7-12(16(18,19)20)21(3)15(22)25/h4-8H,1-3H3
SMILES:CC(C)OC(=O)c1cc(ccc1Cl)n1c(=O)cc(C(F)(F)F)n(C)c1=O
Synonyms:- Flupropacil [ISO]
- Flupropacil
- propan-2-yl 2-chloro-5-[3-methyl-2,6-dioxo-4-(trifluoromethyl)-3,6-dihydropyrimidin-1(2H)-yl]benzoate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.