CAS 120905-00-2
:(6R,7R,6'R,7'R)-3,3'-(disulfanediyldimethanediyl)bis(7-{[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid)
Description:
The chemical substance with the name "(6R,7R,6'R,7'R)-3,3'-(disulfanediyldimethanediyl)bis(7-{[(2E)-2-(2-amino-1,3-thiazol-4-yl)-2-(methoxyimino)acetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid)" and CAS number "120905-00-2" is a complex organic compound characterized by its intricate structure, which includes multiple functional groups and stereocenters. This compound features a disulfide linkage, indicating the presence of sulfur atoms that can participate in redox reactions, potentially influencing its biological activity. The thiazole and oxo-bicyclic components suggest that it may exhibit significant pharmacological properties, possibly acting as an antibiotic or antimicrobial agent. The methoxyimino and carboxylic acid functionalities contribute to its solubility and reactivity, making it suitable for various chemical interactions. Overall, this compound's unique structural features and functional groups suggest potential applications in medicinal chemistry, particularly in the development of novel therapeutic agents. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C28H28N10O10S6
InChI:InChI=1/C28H28N10O10S6/c1-47-35-13(11-7-51-27(29)31-11)19(39)33-15-21(41)37-17(25(43)44)9(3-49-23(15)37)5-53-54-6-10-4-50-24-16(22(42)38(24)18(10)26(45)46)34-20(40)14(36-48-2)12-8-52-28(30)32-12/h7-8,15-16,23-24H,3-6H2,1-2H3,(H2,29,31)(H2,30,32)(H,33,39)(H,34,40)(H,43,44)(H,45,46)/b35-13+,36-14+/t15-,16-,23-,24-/m1/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Desfuroyl Ceftiofur Dimer (>90%)
CAS:Controlled Product<p>Stability Hygroscopic<br>Applications Desfuroyl Ceftiofur Dimer is an impurity of the drug Ceftiofur (C244695), a third generation cephalosporin antibiotic used in veterinary medicine.<br>References Donaldson, S.C. et al.: Appl. Environ. Microbiol., 72, 3940 (2006); Yancey, R.J. et al.: Am. J. Vet. Res., 48, 1050 (1987);<br></p>Formula:C28H28N10O10S6Purity:>90%Color and Shape:NeatMolecular weight:856.97Desfuroyl ceftiofur dimer
CAS:<p>Desfuroyl ceftiofur dimer is a medicinal compound that has shown potential as an anticancer agent in human tumor cells. It induces apoptosis, or programmed cell death, in cancer cells by acting as a kinase inhibitor. This compound is an analog of lincomycin and has been found to inhibit the growth of cancer cells in Chinese hamster ovary cells. Desfuroyl ceftiofur dimer is excreted in urine and has been studied for its potential use as a therapeutic agent for various types of cancer. Its inhibitory effects on protein synthesis make it a promising candidate for further research into novel anticancer therapies.</p>Formula:C28H28N10O10S6Purity:Min. 95%Molecular weight:857 g/mol


