CAS 1209050-27-0

(αS)-α-(Trifluoromethyl)-3-thiophenemethanamine

Description:

(αS)-α-(Trifluoromethyl)-3-thiophenemethanamine is a chemical compound characterized by its unique structural features, including a trifluoromethyl group and a thiophene ring. The presence of the trifluoromethyl group contributes to its lipophilicity and can influence its reactivity and biological activity. The thiophene moiety, a five-membered aromatic ring containing sulfur, imparts additional stability and can participate in various chemical interactions. This compound is likely to exhibit specific pharmacological properties, making it of interest in medicinal chemistry and drug development. Its stereochemistry, indicated by the (αS) designation, suggests that it may have distinct enantiomeric forms, which can lead to differences in biological activity and interactions with biological targets. The CAS number 1209050-27-0 provides a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the combination of these functional groups and structural features makes (αS)-α-(Trifluoromethyl)-3-thiophenemethanamine a compound of potential interest in various fields, including pharmaceuticals and materials science.

Formula: C₆H₆F₃NS

InChI: InChI=1S/C6H6F3NS/c7-6(8,9)5(10)4-1-2-11-3-4/h1-3,5H,10H2/t5-/m0/s1

InChI key: InChIKey=MOYLBHXBCYMVJQ-YFKPBYRVSA-N

SMILES: [C@H](C(F)(F)F)(N)C=1C=CSC1

Synonyms:

• (1S)-2,2,2-Trifluoro-1-(thiophen-3-yl)ethan-1-amine
• 3-Thiophenemethanamine, α-(trifluoromethyl)-, (αS)-
• (αS)-α-(Trifluoromethyl)-3-thiophenemethanamine