CAS 120926-46-7
:Isoliquiritin apioside
Description:
Isoliquiritin apioside is a flavonoid glycoside derived from licorice root, specifically from the plant Glycyrrhiza uralensis. It is known for its potential health benefits, including antioxidant, anti-inflammatory, and hepatoprotective properties. The compound features a flavonoid backbone with an apiosyl group attached, which contributes to its biological activity. Isoliquiritin apioside is often studied for its role in traditional medicine and its potential applications in modern therapeutics. It exhibits solubility in polar solvents, making it suitable for various extraction and formulation processes. Additionally, research indicates that it may have effects on metabolic pathways, potentially influencing conditions such as diabetes and obesity. Its safety profile is generally considered favorable, although further studies are necessary to fully understand its pharmacokinetics and long-term effects. Overall, isoliquiritin apioside represents a significant area of interest in phytochemistry and natural product research, highlighting the importance of plant-derived compounds in health and disease management.
Formula:C26H30O13
InChI:InChI=1S/C26H30O13/c27-10-19-20(32)21(33)22(39-25-23(34)26(35,11-28)12-36-25)24(38-19)37-15-5-1-13(2-6-15)3-8-17(30)16-7-4-14(29)9-18(16)31/h1-9,19-25,27-29,31-35H,10-12H2/b8-3+/t19-,20-,21+,22-,23+,24-,25+,26-/m1/s1
InChI key:InChIKey=VMMVZVPAYFZNBM-KVFWHIKKSA-N
SMILES:O([C@H]1[C@H](OC2=CC=C(/C=C/C(=O)C3=C(O)C=C(O)C=C3)C=C2)O[C@H](CO)[C@@H](O)[C@@H]1O)[C@H]4[C@H](O)[C@](CO)(O)CO4
Synonyms:- (2E)-3-[4-[(2-O-<span class="text-smallcaps">D</smallcap>-Apio-β-<smallcap>D</smallcap>-furanosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]phenyl]-1-(2,4-dihydroxyphenyl)-2-propen-1-one
- 2-Propen-1-one, 3-[4-[(2-O-<span class="text-smallcaps">D</smallcap>-apio-β-<smallcap>D</smallcap>-furanosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]phenyl]-1-(2,4-dihydroxyphenyl)-, (2E)-
- 2-Propen-1-one, 3-[4-[(2-O-<span class="text-smallcaps">D</smallcap>-apio-β-<smallcap>D</smallcap>-furanosyl-β-<smallcap>D</span>-glucopyranosyl)oxy]phenyl]-1-(2,4-dihydroxyphenyl)-, (E)-
- Isoliquiritigenin-4′-O-apiosyl(1→2)glucoside
- Isoliquiritin Apioside
- Neolicuroside
- (2E)-3-[4-[(2-O-D-Apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-1-(2,4-dihydroxyphenyl)-2-propen-1-one
- 2-Propen-1-one, 3-[4-[(2-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-1-(2,4-dihydroxyphenyl)-, (E)-
- 2-Propen-1-one, 3-[4-[(2-O-D-apio-β-D-furanosyl-β-D-glucopyranosyl)oxy]phenyl]-1-(2,4-dihydroxyphenyl)-, (2E)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Isoliquiritin apioside
CAS:Isoliquiritin apioside, from Glycyrrhizae radix, inhibits MMP9, MAPK, NF-κB, reduces cancer cell invasion, angiogenesis, and fights oxidative DNA damage.Formula:C26H30O13Purity:98.84% - 99.27%Color and Shape:SolidMolecular weight:550.51Isoliquiritin apioside
CAS:Isoliquiritin apioside is a flavonoid glycoside, which is a compound derived from licorice root (Glycyrrhiza species). It exhibits a range of biological activities by influencing various cellular and molecular pathways, often involving antioxidant and anti-inflammatory mechanisms. These effects are primarily mediated through its interaction with cellular signaling cascades, potentially modulating gene expression and enzyme activity.
Formula:C26H30O13Purity:Min. 95%Color and Shape:PowderMolecular weight:550.51 g/mol





