CAS 1209458-77-4

2-Bromo-4-(1-piperidinyl)pyrimidine

Description:

2-Bromo-4-(1-piperidinyl)pyrimidine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 2-position and a piperidine group at the 4-position contributes to its unique reactivity and potential biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. Its structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to the presence of the piperidine moiety, which is often associated with various biological activities. The compound may also participate in nucleophilic substitution reactions due to the bromine atom, making it a useful intermediate in organic synthesis. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks. Overall, 2-Bromo-4-(1-piperidinyl)pyrimidine is of interest in both research and industrial applications.

Formula: C₉H₁₂BrN₃

InChI: InChI=1S/C9H12BrN3/c10-9-11-5-4-8(12-9)13-6-2-1-3-7-13/h4-5H,1-3,6-7H2

InChI key: InChIKey=QQBSDZQNDZMCLT-UHFFFAOYSA-N

SMILES: BrC=1N=C(C=CN1)N2CCCCC2

Synonyms:

• 2-Bromo-4-(1-piperidinyl)pyrimidine
• Pyrimidine, 2-bromo-4-(1-piperidinyl)-