
CAS 1209458-85-4
:2-Bromo-4-pyrimidinecarboxamide
Description:
2-Bromo-4-pyrimidinecarboxamide is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a bromine atom at the 2-position and a carboxamide functional group at the 4-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and is soluble in polar organic solvents. It may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of new therapeutic agents. The bromine substituent can enhance the compound's lipophilicity and influence its interaction with biological targets. Additionally, the carboxamide group can participate in hydrogen bonding, affecting its solubility and stability. As with many halogenated compounds, safety precautions should be taken when handling 2-Bromo-4-pyrimidinecarboxamide due to potential toxicity and environmental impact. Overall, its structural features make it a valuable compound for various applications in organic synthesis and medicinal chemistry.
Formula:C5H4BrN3O
InChI:InChI=1S/C5H4BrN3O/c6-5-8-2-1-3(9-5)4(7)10/h1-2H,(H2,7,10)
InChI key:InChIKey=CQTWUUFIDKLNPU-UHFFFAOYSA-N
SMILES:C(N)(=O)C1=NC(Br)=NC=C1
Synonyms:- 2-Bromo-4-pyrimidinecarboxamide
- 4-Pyrimidinecarboxamide, 2-bromo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
