CymitQuimica logo

CAS 1209459-26-6

:

5-Bromo-N-cyclopropyl-3-pyridinamine

Description:
5-Bromo-N-cyclopropyl-3-pyridinamine is a chemical compound characterized by its unique structural features, which include a bromine atom and a cyclopropyl group attached to a pyridine ring. The presence of the bromine substituent typically enhances the compound's reactivity, making it useful in various synthetic applications. The cyclopropyl group contributes to the compound's overall rigidity and can influence its biological activity, potentially affecting how it interacts with biological targets. As a pyridinamine, it contains an amino group (-NH2) that can participate in hydrogen bonding, which may enhance its solubility in polar solvents. This compound may be of interest in medicinal chemistry for its potential pharmacological properties, particularly in the development of new therapeutic agents. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, 5-Bromo-N-cyclopropyl-3-pyridinamine represents a versatile scaffold for further chemical exploration and application.
Formula:C8H9BrN2
InChI:InChI=1S/C8H9BrN2/c9-6-3-8(5-10-4-6)11-7-1-2-7/h3-5,7,11H,1-2H2
InChI key:InChIKey=AWXJVLYODIKXPY-UHFFFAOYSA-N
SMILES:N(C1CC1)C=2C=C(Br)C=NC2
Synonyms:
  • 3-Pyridinamine, 5-bromo-N-cyclopropyl-
  • 5-Bromo-N-cyclopropyl-3-pyridinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.