CAS 1209459-48-2

3-Bromo-5-cyclohexylpyridine

Description:

3-Bromo-5-cyclohexylpyridine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 3-position and a cyclohexyl group at the 5-position contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is likely to be soluble in organic solvents due to its hydrophobic cyclohexyl group, while the pyridine nitrogen may impart some polar characteristics. The bromine substituent can participate in various chemical reactions, such as nucleophilic substitution or coupling reactions, making it a useful intermediate in organic synthesis. Additionally, the compound may exhibit biological activity, which could be of interest in medicinal chemistry. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 3-Bromo-5-cyclohexylpyridine is a versatile compound with potential applications in various fields of chemistry.

Formula: C₁₁H₁₄BrN

InChI: InChI=1S/C11H14BrN/c12-11-6-10(7-13-8-11)9-4-2-1-3-5-9/h6-9H,1-5H2

InChI key: InChIKey=GKIAJCAULUPYJH-UHFFFAOYSA-N

SMILES: BrC1=CC(=CN=C1)C2CCCCC2

Synonyms:

• Pyridine, 3-bromo-5-cyclohexyl-
• 3-Bromo-5-cyclohexylpyridine