CymitQuimica logo

CAS 1209459-71-1

:

N-(5-Bromo-3-pyridinyl)cyclopropanecarboxamide

Description:
N-(5-Bromo-3-pyridinyl)cyclopropanecarboxamide is a chemical compound characterized by its unique structural features, which include a cyclopropane ring and a pyridine moiety substituted with a bromine atom. The presence of the bromine atom at the 5-position of the pyridine ring enhances the compound's reactivity and may influence its biological activity. The carboxamide functional group contributes to the compound's polarity and solubility in various solvents, making it suitable for a range of chemical reactions and applications. This compound may exhibit interesting pharmacological properties, potentially acting as a ligand or inhibitor in biological systems. Its molecular structure suggests potential interactions with biological targets, which could be explored in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the bromine and the nitrogen in the pyridine ring. Overall, N-(5-Bromo-3-pyridinyl)cyclopropanecarboxamide represents a valuable compound for research in organic synthesis and drug development.
Formula:C9H9BrN2O
InChI:InChI=1S/C9H9BrN2O/c10-7-3-8(5-11-4-7)12-9(13)6-1-2-6/h3-6H,1-2H2,(H,12,13)
InChI key:InChIKey=OZRPEDYWQLEFPU-UHFFFAOYSA-N
SMILES:C(NC=1C=C(Br)C=NC1)(=O)C2CC2
Synonyms:
  • N-(5-Bromo-3-pyridinyl)cyclopropanecarboxamide
  • Cyclopropanecarboxamide, N-(5-bromo-3-pyridinyl)-
  • N-(5-Bromopyridin-3-yl)cyclopropanecarboxamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.