CAS 120952-68-3

Pentanamide, 2-amino-N-butyl-3-methyl-, [S-(R*,R*)]-

Description:

Pentanamide, 2-amino-N-butyl-3-methyl-, [S-(R*,R*)]- is an organic compound characterized by its amide functional group, which is derived from pentanoic acid. This substance features a butyl group and a methyl group attached to the nitrogen atom, contributing to its unique structural properties. The presence of the amino group indicates that it can participate in hydrogen bonding, which affects its solubility and reactivity. The stereochemistry denoted by [S-(R*,R*)] suggests that the compound has specific chiral centers, influencing its biological activity and interactions with other molecules. Typically, such compounds may exhibit moderate to high polarity due to the amide and amino functionalities, which can impact their physical properties, such as melting and boiling points. Additionally, the compound may have applications in pharmaceuticals or as a biochemical reagent, given its structural features that allow for potential interactions with biological systems. Overall, the characteristics of this compound make it of interest in both synthetic and medicinal chemistry contexts.

Formula: C₁₀H₂₂N₂O

InChI: InChI=1S/C10H22N2O/c1-4-6-7-12-10(13)9(11)8(3)5-2/h8-9H,4-7,11H2,1-3H3,(H,12,13)/t8-,9-/m0/s1

InChI key: InChIKey=ZCLXOGKYLYWKDL-IUCAKERBSA-N

SMILES: [C@@H](C(NCCCC)=O)([C@H](CC)C)N

Synonyms:

• Pentanamide, 2-amino-N-butyl-3-methyl-, [S-(R*,R*)]-