CAS 120958-24-9

2-Methoxy-β-methylbenzenepropanol

Description:

2-Methoxy-β-methylbenzenepropanol, also known by its CAS number 120958-24-9, is an organic compound characterized by its structure, which includes a methoxy group and a propanol moiety attached to a β-methylbenzene ring. This compound typically exhibits properties common to alcohols, such as being a polar substance due to the hydroxyl (-OH) group, which can engage in hydrogen bonding, influencing its solubility in water and other polar solvents. The presence of the methoxy group enhances its hydrophobic characteristics, making it less soluble in water compared to simple alcohols. Its molecular structure suggests potential applications in the synthesis of pharmaceuticals or as an intermediate in organic reactions. Additionally, the compound may exhibit specific reactivity patterns typical of alcohols, such as oxidation and esterification. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken due to potential toxicity or reactivity.

Formula: C₁₁H₁₆O₂

InChI: InChI=1S/C11H16O2/c1-9(8-12)7-10-5-3-4-6-11(10)13-2/h3-6,9,12H,7-8H2,1-2H3

InChI key: InChIKey=SIKJORVOXZHMHW-UHFFFAOYSA-N

SMILES: C(C(CO)C)C1=C(OC)C=CC=C1

Synonyms:

• Benzenepropanol, 2-methoxy-β-methyl-
• 2-Methoxy-β-methylbenzenepropanol