CAS 120990-94-5

2-Piperidinemethanamine, N,N-diethyl-, (R)-

Description:

2-Piperidinemethanamine, N,N-diethyl-, (R)-, also known by its CAS number 120990-94-5, is a chiral amine characterized by a piperidine ring and a diethylamino group attached to a methanamine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds, which can influence its solubility in polar and non-polar solvents. The presence of the piperidine ring contributes to its cyclic structure, which can affect its reactivity and interaction with biological systems. As a chiral compound, it may exhibit enantioselectivity in chemical reactions and biological activity, making it of interest in pharmaceutical applications. Its specific stereochemistry can influence its pharmacokinetic and pharmacodynamic properties, potentially impacting its efficacy and safety profile in medicinal chemistry. Overall, 2-Piperidinemethanamine, N,N-diethyl-, (R)- is a compound of interest in both synthetic organic chemistry and drug development due to its unique structural features and potential biological activities.

Formula: C₁₀H₂₂N₂

InChI: InChI=1S/C10H22N2/c1-3-12(4-2)9-10-7-5-6-8-11-10/h10-11H,3-9H2,1-2H3/t10-/m1/s1

InChI key: InChIKey=WTIYGHQFUHZRDA-SNVBAGLBSA-N

SMILES: C(N(CC)CC)[C@H]1CCCCN1

Synonyms:

• 2-Piperidinemethanamine, N,N-diethyl-, (R)-