
CAS 1209905-41-8
:2-Bromo-3-methoxypyrazine
Description:
2-Bromo-3-methoxypyrazine is a chemical compound characterized by its pyrazine ring, which is a six-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the second position and a methoxy group (-OCH3) at the third position of the pyrazine ring contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its distinctive odor, which can be described as earthy or green, making it of interest in the flavor and fragrance industry. The bromine substituent can enhance the compound's reactivity, allowing for various chemical transformations. Additionally, the methoxy group can influence the compound's solubility and polarity. 2-Bromo-3-methoxypyrazine may also exhibit biological activity, making it a subject of interest in medicinal chemistry and agrochemical research. As with many halogenated compounds, safety precautions should be taken when handling it due to potential toxicity and environmental impact.
Formula:C5H5BrN2O
InChI:InChI=1S/C5H5BrN2O/c1-9-5-4(6)7-2-3-8-5/h2-3H,1H3
SMILES:COc1c(Br)nccn1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2-Bromo-3-methoxypyrazine
CAS:Formula:C5H5BrN2OPurity:98%Color and Shape:SolidMolecular weight:189.01002-Bromo-3-methoxypyrazine
CAS:2-Bromo-3-methoxypyrazine is a chemical compound that is used as a precursor in the biosynthesis of geosmin. Geosmin, also known as 2-methylisoborneol or 2-MIB, is a volatile organic compound which has a musty or earthy smell. It is produced by some species of bacteria, including Myxobacterium and Chondromyces crocatus. It can be found in soil and water samples from areas with high levels of organic matter. 2-Bromo-3-methoxypyrazine was first isolated from cultures of M. crocatus in 1950. It can be synthesized from 3,4,5-trimethoxybenzaldehyde via bromination followed by reduction with sodium hydrosulfide. This process creates an intermediate called 2-(2'-bromoethyl)pyrazine, which undergoes methylation to create 2Formula:C5H5BrN2OPurity:Min. 95%Color and Shape:White Off-White PowderMolecular weight:189.01 g/mol2-Bromo-3-methoxypyrazine
CAS:Formula:C5H5BrN2OPurity:98%Color and Shape:SolidMolecular weight:189.012



