CAS 120991-47-1
:2,2',3,4,5,5'-hexabromobiphenyl
Description:
2,2',3,4,5,5'-Hexabromobiphenyl is a synthetic organic compound belonging to the class of brominated biphenyls, which are known for their flame-retardant properties. This compound features six bromine atoms substituted on a biphenyl structure, significantly altering its physical and chemical characteristics. It is typically a solid at room temperature and exhibits high thermal stability, making it suitable for applications requiring flame resistance. However, its persistence in the environment raises concerns regarding bioaccumulation and potential toxicity to aquatic life and humans. The compound is not readily biodegradable, leading to its classification as a persistent organic pollutant (POP). Regulatory measures may restrict its use due to environmental and health implications. Additionally, 2,2',3,4,5,5'-hexabromobiphenyl may undergo various degradation pathways under specific conditions, but its stability in the environment poses challenges for remediation efforts. Overall, while it serves important industrial functions, its environmental impact necessitates careful management and consideration in its application.
Formula:C12H4Br6
InChI:InChI=1/C12H4Br6/c13-5-1-2-8(14)6(3-5)7-4-9(15)11(17)12(18)10(7)16/h1-4H
SMILES:c1cc(c(cc1Br)c1cc(c(c(c1Br)Br)Br)Br)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.