CymitQuimica logo

CAS 121-40-4

:

(1R,6S)-3-Hydroxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione

Description:
(1R,6S)-3-Hydroxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione, with the CAS number 121-40-4, is a bicyclic organic compound characterized by its unique structural features, including a hydroxyl group and a dione functional group. This compound exhibits a bicyclic framework, which contributes to its rigidity and potential reactivity. The presence of the hydroxyl group suggests that it can participate in hydrogen bonding, influencing its solubility and interaction with other molecules. The dione functionality indicates that it may undergo various chemical reactions, such as nucleophilic attacks or oxidation. Additionally, the specific stereochemistry denoted by the (1R,6S) configuration implies that the compound has distinct spatial arrangements, which can affect its biological activity and interactions with enzymes or receptors. Overall, this compound's unique structure and functional groups make it of interest in fields such as organic synthesis, medicinal chemistry, and materials science, where its properties can be exploited for various applications.
Formula:C7H6O4
InChI:InChI=1S/C7H6O4/c1-2-3(8)5(10)7-6(11-7)4(2)9/h6-8H,1H3/t6-,7+/m1/s1
InChI key:InChIKey=ATFNSNUJZOYXFC-RQJHMYQMSA-N
SMILES:O=C1[C@@]2([C@@](O2)(C(=O)C(O)=C1C)[H])[H]
Synonyms:
  • (1R,6S)-3-hydroxy-4-methyl-7-oxabicyclo[4.1.0]hept-3-ene-2,5-dione
  • 7-Oxabicyclo[4.1.0]hept-3-ene-2,5-dione, 3-hydroxy-4-methyl-, (1R)-
  • 7-Oxabicyclo[4.1.0]hept-3-ene-2,5-dione, 3-hydroxy-4-methyl-, (1R,6S)-
  • 7-Oxabicyclo[4.1.0]hept-3-ene-2,5-dione, 3-hydroxy-4-methyl-, stereoisomer
  • Terreic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.