CAS 121-48-2
:3,5-Disulfobenzoic acid
Description:
3,5-Disulfobenzoic acid, with the CAS number 121-48-2, is an aromatic sulfonic acid characterized by the presence of two sulfonyl (–SO3H) groups attached to a benzene ring at the 3 and 5 positions. This compound is typically a white to pale yellow solid that is soluble in water due to the polar nature of the sulfonic acid groups. It exhibits acidic properties, allowing it to donate protons in solution, and is often used in various chemical applications, including as a reagent in organic synthesis and in the preparation of dyes and pharmaceuticals. The presence of multiple sulfonic acid groups enhances its reactivity and makes it a useful intermediate in the synthesis of other chemical compounds. Additionally, 3,5-disulfobenzoic acid can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in research and industrial applications. Its stability and solubility in aqueous environments further contribute to its utility in diverse chemical processes.
Formula:C7H6O8S2
InChI:InChI=1/C7H6O8S2/c8-7(9)4-1-5(16(10,11)12)3-6(2-4)17(13,14)15/h1-3H,(H,8,9)(H,10,11,12)(H,13,14,15)
InChI key:InChIKey=LZRAAMHXKXNHEF-UHFFFAOYSA-N
SMILES:S(=O)(=O)(O)C1=CC(S(=O)(=O)O)=CC(C(O)=O)=C1
Synonyms:- Benzoic acid, 3,5-disulfo-
- 3,5-Disulfobenzoic acid
- 3,5-disulfobenzoic acid
- 3,5-Disulphobenzoic acid
- 2-(3,6-dioxo-1,2-dihydropyridazin-4-yl)acetic acid
- 3,5-disulfo-benzoic aci
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3,5-Disulfobenzoic Acid
CAS:Controlled ProductFormula:C7H6O8S2Color and Shape:NeatMolecular weight:282.24
