
CAS 1210041-68-1
:3-Fluoro-1,2-dihydro-2-oxo-4-pyridinecarbonitrile
Description:
3-Fluoro-1,2-dihydro-2-oxo-4-pyridinecarbonitrile, with the CAS number 1210041-68-1, is a heterocyclic organic compound characterized by its pyridine ring structure, which incorporates a fluorine atom and a carbonitrile functional group. The presence of the carbonitrile group contributes to its potential as a versatile building block in organic synthesis and medicinal chemistry. The compound exhibits a dihydro-2-oxo structure, indicating the presence of a ketone functionality, which can influence its reactivity and interactions with biological targets. Its fluorine substituent may enhance lipophilicity and metabolic stability, making it of interest in drug design. The compound's unique structural features suggest potential applications in pharmaceuticals, particularly in the development of novel therapeutic agents. Additionally, its physical properties, such as solubility and melting point, would be influenced by the functional groups present, which are critical for understanding its behavior in various chemical environments. Overall, 3-Fluoro-1,2-dihydro-2-oxo-4-pyridinecarbonitrile represents a significant compound for further exploration in chemical research and development.
Formula:C6H3FN2O
InChI:InChI=1S/C6H3FN2O/c7-5-4(3-8)1-2-9-6(5)10/h1-2H,(H,9,10)
InChI key:InChIKey=LWOAGOBKGWDVLW-UHFFFAOYSA-N
SMILES:C(#N)C1=C(F)C(=O)NC=C1
Synonyms:- 3-Fluoro-1,2-dihydro-2-oxo-4-pyridinecarbonitrile
- 4-Pyridinecarbonitrile, 3-fluoro-1,2-dihydro-2-oxo-
- 3-Fluoro-2-hydroxyisonicotinonitrile
- 3-Fluoro-2-hydroxypyridine-4-carbonitrile
- 3-Fluoro-2-oxo-1,2-dihydropyridine-4-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.