CymitQuimica logo

CAS 1210047-84-9

:

7-Bromo-N,N-dimethyl-2-quinoxalinamine

Description:
7-Bromo-N,N-dimethyl-2-quinoxalinamine is a chemical compound characterized by its quinoxaline structure, which consists of a fused bicyclic system containing two nitrogen atoms. The presence of a bromine atom at the 7-position of the quinoxaline ring contributes to its reactivity and potential applications in various chemical reactions. The N,N-dimethyl substituents enhance its solubility and may influence its biological activity. This compound is typically used in research settings, particularly in medicinal chemistry, due to its potential as a pharmacophore in drug development. Its unique structural features may allow for interactions with biological targets, making it a subject of interest in studies related to cancer, neurodegenerative diseases, or other therapeutic areas. Additionally, the compound's properties, such as melting point, solubility, and spectral characteristics, can vary based on the specific conditions under which it is synthesized or stored. As with many chemical substances, safety precautions should be observed when handling it, given the potential hazards associated with brominated compounds.
Formula:C10H10BrN3
InChI:InChI=1S/C10H10BrN3/c1-14(2)10-6-12-8-4-3-7(11)5-9(8)13-10/h3-6H,1-2H3
InChI key:InChIKey=AVQYOAUKOCETPV-UHFFFAOYSA-N
SMILES:N(C)(C)C1=NC2=C(N=C1)C=CC(Br)=C2
Synonyms:
  • 2-Quinoxalinamine, 7-bromo-N,N-dimethyl-
  • 7-Bromo-N,N-dimethylquinoxalin-2-amine
  • 7-Bromo-N,N-dimethyl-2-quinoxalinamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.