CAS 121010-86-4

2-Pyrrolidinone,3-amino-,(R)-(9CI)

Description:

2-Pyrrolidinone, 3-amino-, (R)-(9CI) is a chiral organic compound characterized by a pyrrolidinone ring with an amino group at the 3-position. This compound is a derivative of pyrrolidinone, which is a five-membered lactam. The presence of the amino group introduces basic properties, allowing it to participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. The (R) designation indicates its specific stereochemistry, which can influence its biological activity and interactions with other molecules. This compound is often studied in the context of pharmaceuticals and agrochemicals due to its potential applications in drug development and synthesis. Its solubility in polar solvents, such as water and alcohols, makes it versatile for various chemical processes. Additionally, the compound's stability under standard conditions and its ability to form hydrogen bonds contribute to its reactivity and utility in organic synthesis. Overall, 2-Pyrrolidinone, 3-amino-, (R)-(9CI) is a significant compound in the field of organic chemistry with implications in medicinal chemistry and material science.

Formula: C₄H₈N₂O

InChI: InChI=1/C4H8N2O/c5-3-1-2-6-4(3)7/h3H,1-2,5H2,(H,6,7)/t3-/m1/s1

SMILES: C1CN=C([C@@H]1N)O

(R)-3-Aminopyrrolidin-2-one

CAS: 121010-86-4

Formula: C₄H₈N₂O

Purity: 95%

Color and Shape: Solid

Molecular weight: 100.1191

Ref: IN-DA00361Q

(R)-3-Aminopyrrolidin-2-one

CAS: 121010-86-4

(R)-3-Aminopyrrolidin-2-one

Purity: 95%

Molecular weight: 100.12g/mol

Ref: 54-OR1045624

(R)-3-Aminopyrrolidin-2-one

CAS: 121010-86-4

(R)-3-Aminopyrrolidin-2-one is a versatile building block used as a reagent, intermediate or speciality chemical in research. CAS No. 121010-86-4 is a fine chemical that can be used to synthesize complex compounds. It is an important intermediate for the synthesis of many biologically active compounds and has been extensively studied as a drug candidate for cancer treatment. (R)-3-Aminopyrrolidin-2-one has also been shown to have antiviral effects against HIV and influenza A virus and may be useful in the treatment of viral infections.

Formula: C₄H₈N₂O

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 100.12 g/mol

Ref: 3D-FA154960

(R)-3-Amino-2-pyrrolidinone

CAS: 121010-86-4

Formula: C₄H₈N₂O

Purity: 95.0%

Color and Shape: Solid

Molecular weight: 100.121

Ref: 10-F046904