CAS 121020-70-0
:ETHYL 2-CYANO-2-(1,3-DIOXOLAN-2-YLIDEN)ACETATE
Description:
Ethyl 2-cyano-2-(1,3-dioxolan-2-yliden)acetate is an organic compound characterized by its unique functional groups, including a cyano group and a dioxolane ring. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity, particularly in nucleophilic addition reactions due to the presence of the cyano group, which can act as an electrophile. The dioxolane moiety contributes to its stability and solubility in various organic solvents. Ethyl 2-cyano-2-(1,3-dioxolan-2-yliden)acetate is often utilized in synthetic organic chemistry, particularly in the preparation of more complex molecules, including pharmaceuticals and agrochemicals. Its properties, such as boiling point, melting point, and solubility, can vary based on environmental conditions and the presence of other substances. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C8H9NO4
InChI:InChI=1/C8H9NO4/c1-2-11-7(10)6(5-9)8-12-3-4-13-8/h2-4H2,1H3
SMILES:CCOC(=O)C(=C1OCCO1)C#N
Synonyms:- Acetic Acid, 2-Cyano-2-(1,3-Dioxolan-2-Ylidene)-, Ethyl Ester
- Ethyl cyano(1,3-dioxolan-2-ylidene)acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ethyl 2-cyano-2-(1,3-dioxolan-2-ylidene)acetate
CAS:Formula:C8H9NO4Color and Shape:SolidMolecular weight:183.1614
