CAS 121032-29-9: Nelarabine
Description:Nelarabine is a synthetic nucleoside analog primarily used in the treatment of certain types of leukemia, particularly T-cell acute lymphoblastic leukemia (T-ALL) and lymphoblastic lymphoma. Its chemical structure is derived from the purine nucleoside guanosine, and it functions as an antimetabolite, interfering with DNA synthesis and repair. The compound is administered intravenously and is known for its ability to penetrate the central nervous system, making it effective against leukemic cells that may infiltrate this area. Nelarabine is characterized by its specific mechanism of action, which involves the conversion to its active form, ara-GTP, that inhibits DNA polymerase and ultimately leads to cell death. Common side effects include myelosuppression, neurotoxicity, and infections due to its impact on the immune system. As a targeted therapy, nelarabine represents a significant advancement in the treatment of hematological malignancies, offering hope for patients with relapsed or refractory disease. Its development underscores the importance of nucleoside analogs in modern oncology.
Formula:C11H15N5O5
InChI:InChI=1S/C11H15N5O5/c1-20-9-5-8(14-11(12)15-9)16(3-13-5)10-7(19)6(18)4(2-17)21-10/h3-4,6-7,10,17-19H,2H2,1H3,(H2,12,14,15)/t4-,6-,7+,10-/m1/s1
InChI key:InChIKey=IXOXBSCIXZEQEQ-UHTZMRCNSA-N
SMILES:OCC1OC(N2C=NC=3C(=NC(=NC32)N)OC)C(O)C1O
- Synonyms:
- 9-β-D-Arabinofuranosyl-6-methoxy-9H-purin-2-amine
- MAY
- Nelzarabine
- 506u
- 9H-Purin-2-amine, 9-β-D-arabinofuranosyl-6-methoxy-
- NELARABINE
- Nelzarabine [USAN]
- 9-beta-D-Arabinofuranosyl-6-methoxy-9H-purin-2-amine
- (2R,3R,4S,5R)-2-(2-aMino-6-Methoxy-9H-purin-9-yl)-5-(hydroxyMethyl)-tetrahydrofuran-3,4-diol
- 9-(D-arabinofuranosyl)-6-methoxy-9H-purin-2-amine
- See more synonyms
