CAS 121041-41-6
:3-Pyridazinamine, 6-(4-methoxyphenoxy)-
Description:
3-Pyridazinamine, 6-(4-methoxyphenoxy)-, identified by its CAS number 121041-41-6, is a chemical compound that features a pyridazine ring substituted with an amine group and a 4-methoxyphenoxy moiety. This compound is characterized by its heterocyclic structure, which contributes to its potential biological activity. The presence of the methoxy group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The amine functional group may participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Additionally, the compound may exhibit properties relevant to medicinal chemistry, such as antimicrobial or anti-inflammatory activities, although specific biological data would be necessary to confirm these effects. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods like crystallization or chromatography. Overall, 3-Pyridazinamine, 6-(4-methoxyphenoxy)- represents a class of compounds that may have applications in pharmaceuticals or agrochemicals, warranting further investigation into its properties and potential uses.
Formula:C11H11N3O2
InChI:InChI=1/C11H11N3O2/c1-15-8-2-4-9(5-3-8)16-11-7-6-10(12)13-14-11/h2-7H,1H3,(H2,12,13)
SMILES:COc1ccc(cc1)Oc1ccc(=N)[nH]n1
Synonyms:- 6-(4-Methoxyphenoxy)-3-pyridazinamine
- 6-(4-Methoxyphenoxy)pyridazin-3-amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
6-(4-Methoxyphenoxy)pyridazin-3-amine
CAS:Formula:C11H11N3O2Color and Shape:SolidMolecular weight:217.2239
