
CAS 121054-30-6
:Butanoic acid, 2,3-diamino-, hydrochloride (1:2), (2R,3R)-rel-
Description:
Butanoic acid, 2,3-diamino-, hydrochloride (1:2), (2R,3R)-rel- is a chemical compound characterized by its structure, which includes a butanoic acid backbone with two amino groups located at the 2 and 3 positions of the carbon chain. This compound is a hydrochloride salt, indicating that it is formed by the reaction of the base form of the diamino acid with hydrochloric acid, resulting in enhanced solubility in water. The (2R,3R)-rel- designation refers to the specific stereochemistry of the molecule, indicating that both chiral centers are in the R configuration. This compound is likely to exhibit properties typical of amino acids, such as being a zwitterion at physiological pH, which means it can carry both a positive and a negative charge. It may also participate in various biochemical processes, potentially acting as a building block for proteins or as a precursor in synthetic pathways. Its hydrochloride form is commonly used in research and pharmaceutical applications due to its stability and solubility.
Formula:C4H10N2O2·2ClH
InChI:InChI=1/C4H10N2O2.2ClH/c1-2(5)3(6)4(7)8;;/h2-3H,5-6H2,1H3,(H,7,8);2*1H/t2-,3-;;/s2
InChI key:InChIKey=DOZGWJGZHSTDJL-UVADYNCRNA-N
SMILES:[C@H]([C@H](C)N)(C(O)=O)N.Cl
Synonyms:- Butanoic acid, 2,3-diamino-, dihydrochloride, (R*,R*)-(±)-
- Butanoic acid, 2,3-diamino-, hydrochloride (1:2), (2R,3R)-rel-
- Butanoic acid, 2,3-diamino-, dihydrochloride, (R*,R*)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
(3S,2S)-2,3-Diaminobutyric Acid Dihydrochloride
CAS:Controlled ProductFormula:C4H10N2O2•2(HCl)Color and Shape:NeatMolecular weight:154.05091


