CAS 121064-74-2
:Tanshinone VI
Description:
Tanshinone VI is a bioactive compound primarily derived from the roots of the Salvia miltiorrhiza plant, commonly known as Danshen. This compound belongs to the class of diterpenes and is recognized for its potential therapeutic properties, particularly in cardiovascular health and anti-inflammatory effects. Tanshinone VI exhibits a complex molecular structure characterized by multiple rings and functional groups, contributing to its biological activity. It has been studied for its antioxidant properties, which may help in protecting cells from oxidative stress. Additionally, research suggests that Tanshinone VI may have neuroprotective effects and could play a role in the treatment of various diseases, including cancer and cardiovascular disorders. Its solubility is generally low in water but may vary in organic solvents, which is a common trait among many natural products. Overall, Tanshinone VI is of significant interest in pharmacological research due to its diverse biological activities and potential health benefits.
Formula:C18H16O4
InChI:InChI=1S/C18H16O4/c1-9-4-3-5-12-11(9)6-7-13-15(12)18(22)17(21)14(16(13)20)10(2)8-19/h3-7,10,19-20H,8H2,1-2H3
InChI key:InChIKey=GRGPQNRHXNRJFL-UHFFFAOYSA-N
SMILES:O=C1C=2C=3C(C=CC2C(O)=C(C(CO)C)C1=O)=C(C)C=CC3
Synonyms:- 1-Hydroxy-2-(1-Hydroxypropan-2-Yl)-8-Methylphenanthrene-3,4-Dione
- 1-Hydroxy-2-(2-hydroxy-1-methylethyl)-8-methyl-3,4-phenanthrenedione
- 3,4-Phenanthrenedione, 1-hydroxy-2-(2-hydroxy-1-methylethyl)-8-methyl-
- Sodium tanshinone VI 1-phenolate
- Tanshinone VI
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
Tanshinone VI
CAS:Tanshinone is a natural compound that can be found in plants such as Salvia miltiorrhiza and Pueraria lobata. Tanshinone VI is a new tanshinone derivative that has been shown to have cardioprotective effects. It blocks the formation of reactive oxygen species (ROS) by inhibiting the activity of glutathione peroxidase (GSH-px). This compound also prevents calcium overload, thereby protecting against cardiac cells from injury caused by an infarction. The cardioprotective effect of Tanshinone VI has been observed in various experimental models and cell lines, including rat hearts and human cancer cell lines.Formula:C18H16O4Purity:Min. 95%Color and Shape:PowderMolecular weight:296.32 g/mol

