CAS 121071-71-4
:Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride
Description:
Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride is a chemical compound characterized by its unique structure, which includes a thiophene ring substituted with amino and carboxylate groups. This compound typically appears as a white to off-white crystalline solid and is soluble in polar solvents such as water and methanol, owing to the presence of the hydrochloride salt form. The presence of the amino group contributes to its basicity, while the carboxylate groups can participate in various chemical reactions, making it a versatile intermediate in organic synthesis. It is often utilized in the development of pharmaceuticals and agrochemicals due to its potential biological activity. The compound's properties, such as melting point and spectral characteristics, can vary based on purity and specific conditions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C8H10ClNO4S
InChI:InChI=1/C8H9NO4S.ClH/c1-12-7(10)5-4(9)3-14-6(5)8(11)13-2;/h3H,9H2,1-2H3;1H
SMILES:COC(=O)c1c(csc1C(=O)OC)N.Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride, 97%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C8H9NO4SPurity:97%Color and Shape:Powder, Pale orange or pale pinkMolecular weight:215.22Dimethyl 4-Aminothiophene-2,3-dicarboxylate hydrochloride
CAS:Formula:C8H10ClNO4SPurity:97%Color and Shape:SolidMolecular weight:251.6873Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloride
CAS:Dimethyl 4-aminothiophene-2,3-dicarboxylate hydrochloridePurity:97%Molecular weight:251.69g/molDimethyl 4-Aminothiophene-2,3-dicarboxylate hydrochloride
CAS:Formula:C8H10ClNO4SPurity:97%Molecular weight:251.68




